C11H16F3N3O2 — CID 115513897
5-amino-1-propyl-3-(4,4,4-trifluorobutyl)pyrimidine-2,4-dione (PubChem CID 115513897) has the molecular formula C11H16F3N3O2 and a molecular weight of 279.26 g/mol. Its IUPAC name is 5-amino-1-propyl-3-(4,4,4-trifluorobutyl)pyrimidine-2,4-dione.
| Compound Name | 5-amino-1-propyl-3-(4,4,4-trifluorobutyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115513897 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 5-amino-1-propyl-3-(4,4,4-trifluorobutyl)pyrimidine-2,4-dione |
| SMILES | CCCn1cc(N)c(=O)n(CCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C11H16F3N3O2/c1-2-5-16-7-8(15)9(18)17(10(16)19)6-3-4-11(12,13)14/h7H,2-6,15H2,1H3 |
| InChIKey | LTKMCIVPTQZYMD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |