C24H32F3N3O6 — CID 68810394
2-methyl-2-[4-[4-[[4-methyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]butyl]phenoxy]pentanoic acid (PubChem CID 68810394) has the molecular formula C24H32F3N3O6 and a molecular weight of 515.53 g/mol. Its IUPAC name is 2-methyl-2-[4-[4-[[4-methyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]butyl]phenoxy]pentanoic acid.
| Compound Name | 2-methyl-2-[4-[4-[[4-methyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]butyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 68810394 |
| Molecular Formula | C24H32F3N3O6 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 2-methyl-2-[4-[4-[[4-methyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]butyl]phenoxy]pentanoic acid |
| SMILES | CCCC(C)(Oc1ccc(CCCCOc2nn(CCCC(F)(F)F)c(=O)n(C)c2=O)cc1)C(=O)O |
| InChI | InChI=1S/C24H32F3N3O6/c1-4-13-23(2,21(32)33)36-18-11-9-17(10-12-18)8-5-6-16-35-19-20(31)29(3)22(34)30(28-19)15-7-14-24(25,26)27/h9-12H,4-8,13-16H2,1-3H3,(H,32,33) |
| InChIKey | XTIUMMRXPHVAFL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|