C23H30F3N3O6 — CID 68820734
2-methyl-2-[3-[3-[[2-methyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]propyl]phenoxy]pentanoic acid (PubChem CID 68820734) has the molecular formula C23H30F3N3O6 and a molecular weight of 501.50 g/mol. Its IUPAC name is 2-methyl-2-[3-[3-[[2-methyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]propyl]phenoxy]pentanoic acid.
| Compound Name | 2-methyl-2-[3-[3-[[2-methyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]propyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 68820734 |
| Molecular Formula | C23H30F3N3O6 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 2-methyl-2-[3-[3-[[2-methyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]propyl]phenoxy]pentanoic acid |
| SMILES | CCCC(C)(Oc1cccc(CCCOc2nn(C)c(=O)n(CCCC(F)(F)F)c2=O)c1)C(=O)O |
| InChI | InChI=1S/C23H30F3N3O6/c1-4-11-22(2,20(31)32)35-17-10-5-8-16(15-17)9-6-14-34-18-19(30)29(21(33)28(3)27-18)13-7-12-23(24,25)26/h5,8,10,15H,4,6-7,9,11-14H2,1-3H3,(H,31,32) |
| InChIKey | UBDYVUSVNSEZLP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|