C24H30F6N4O5 — CID 87584537
2-[3-[3-[[3,5-dioxo-2,4-bis(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]propyl]phenoxy]-2-methylpropanoic acid (PubChem CID 87584537) has the molecular formula C24H30F6N4O5 and a molecular weight of 568.52 g/mol. Its IUPAC name is 2-[3-[3-[[3,5-dioxo-2,4-bis(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]propyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[3-[3-[[3,5-dioxo-2,4-bis(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]propyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 87584537 |
| Molecular Formula | C24H30F6N4O5 |
| Molecular Weight | 568.52 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 2-[3-[3-[[3,5-dioxo-2,4-bis(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]propyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1cccc(CCCNc2nn(CCCC(F)(F)F)c(=O)n(CCCC(F)(F)F)c2=O)c1)C(=O)O |
| InChI | InChI=1S/C24H30F6N4O5/c1-22(2,20(36)37)39-17-9-3-7-16(15-17)8-4-12-31-18-19(35)33(13-5-10-23(25,26)27)21(38)34(32-18)14-6-11-24(28,29)30/h3,7,9,15H,4-6,8,10-14H2,1-2H3,(H,31,32)(H,36,37) |
| InChIKey | WNCXPSVFIAQKNT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|