C32H48N4O8 — CID 68580991
ethyl 4-[6-[4-[3-(1-ethoxy-2-methyl-1-oxopropan-2-yl)oxyphenyl]butylamino]-4-heptyl-3,5-dioxo-1,2,4-triazin-2-yl]-2-oxobutanoate (PubChem CID 68580991) has the molecular formula C32H48N4O8 and a molecular weight of 616.76 g/mol. Its IUPAC name is ethyl 4-[6-[4-[3-(1-ethoxy-2-methyl-1-oxopropan-2-yl)oxyphenyl]butylamino]-4-heptyl-3,5-dioxo-1,2,4-triazin-2-yl]-2-oxobutanoate.
| Compound Name | ethyl 4-[6-[4-[3-(1-ethoxy-2-methyl-1-oxopropan-2-yl)oxyphenyl]butylamino]-4-heptyl-3,5-dioxo-1,2,4-triazin-2-yl]-2-oxobutanoate |
|---|---|
| PubChem CID | 68580991 |
| Molecular Formula | C32H48N4O8 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.35 |
| IUPAC Name | ethyl 4-[6-[4-[3-(1-ethoxy-2-methyl-1-oxopropan-2-yl)oxyphenyl]butylamino]-4-heptyl-3,5-dioxo-1,2,4-triazin-2-yl]-2-oxobutanoate |
| SMILES | CCCCCCCn1c(=O)c(NCCCCc2cccc(OC(C)(C)C(=O)OCC)c2)nn(CCC(=O)C(=O)OCC)c1=O |
| InChI | InChI=1S/C32H48N4O8/c1-6-9-10-11-14-21-35-28(38)27(34-36(31(35)41)22-19-26(37)29(39)42-7-2)33-20-13-12-16-24-17-15-18-25(23-24)44-32(4,5)30(40)43-8-3/h15,17-18,23H,6-14,16,19-22H2,1-5H3,(H,33,34) |
| InChIKey | GGOXOAOVEUBWKT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|