C30H40N4O5 — CID 68809827
2-[3-[3-[(2-benzyl-4-heptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]propyl]phenoxy]-2-methylpropanoic acid (PubChem CID 68809827) has the molecular formula C30H40N4O5 and a molecular weight of 536.67 g/mol. Its IUPAC name is 2-[3-[3-[(2-benzyl-4-heptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]propyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[3-[3-[(2-benzyl-4-heptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]propyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 68809827 |
| Molecular Formula | C30H40N4O5 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | 2-[3-[3-[(2-benzyl-4-heptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]propyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CCCCCCCn1c(=O)c(NCCCc2cccc(OC(C)(C)C(=O)O)c2)nn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C30H40N4O5/c1-4-5-6-7-11-20-33-27(35)26(32-34(29(33)38)22-24-14-9-8-10-15-24)31-19-13-17-23-16-12-18-25(21-23)39-30(2,3)28(36)37/h8-10,12,14-16,18,21H,4-7,11,13,17,19-20,22H2,1-3H3,(H,31,32)(H,36,37) |
| InChIKey | RBRABPRLQYBPTD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|