C33H46N4O5 — CID 11853849
ethyl 2-[3-[4-[(4-benzyl-2-heptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]butyl]phenoxy]-2-methylpropanoate (PubChem CID 11853849) has the molecular formula C33H46N4O5 and a molecular weight of 578.75 g/mol. Its IUPAC name is ethyl 2-[3-[4-[(4-benzyl-2-heptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]butyl]phenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[3-[4-[(4-benzyl-2-heptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]butyl]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 11853849 |
| Molecular Formula | C33H46N4O5 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | ethyl 2-[3-[4-[(4-benzyl-2-heptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]butyl]phenoxy]-2-methylpropanoate |
| SMILES | CCCCCCCn1nc(NCCCCc2cccc(OC(C)(C)C(=O)OCC)c2)c(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C33H46N4O5/c1-5-7-8-9-15-23-37-32(40)36(25-27-18-11-10-12-19-27)30(38)29(35-37)34-22-14-13-17-26-20-16-21-28(24-26)42-33(3,4)31(39)41-6-2/h10-12,16,18-21,24H,5-9,13-15,17,22-23,25H2,1-4H3,(H,34,35) |
| InChIKey | IKTPMALLCUEBEB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|