C26H40N4O6 — CID 68810702
2-[4-[3-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]propoxy]phenoxy]-2-methylpentanoic acid (PubChem CID 68810702) has the molecular formula C26H40N4O6 and a molecular weight of 504.63 g/mol. Its IUPAC name is 2-[4-[3-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]propoxy]phenoxy]-2-methylpentanoic acid.
| Compound Name | 2-[4-[3-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]propoxy]phenoxy]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 68810702 |
| Molecular Formula | C26H40N4O6 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | 2-[4-[3-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]propoxy]phenoxy]-2-methylpentanoic acid |
| SMILES | CCCCCCCn1c(=O)c(NCCCOc2ccc(OC(C)(CCC)C(=O)O)cc2)nn(C)c1=O |
| InChI | InChI=1S/C26H40N4O6/c1-5-7-8-9-10-18-30-23(31)22(28-29(4)25(30)34)27-17-11-19-35-20-12-14-21(15-13-20)36-26(3,16-6-2)24(32)33/h12-15H,5-11,16-19H2,1-4H3,(H,27,28)(H,32,33) |
| InChIKey | NPDDAWXEYPGNGN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|