C23H31F3N4O5 — CID 68812807
2-[4-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)-(4,4,4-trifluorobutyl)amino]ethyl]phenoxy]-2-methylpentanoic acid (PubChem CID 68812807) has the molecular formula C23H31F3N4O5 and a molecular weight of 500.52 g/mol. Its IUPAC name is 2-[4-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)-(4,4,4-trifluorobutyl)amino]ethyl]phenoxy]-2-methylpentanoic acid.
| Compound Name | 2-[4-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)-(4,4,4-trifluorobutyl)amino]ethyl]phenoxy]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 68812807 |
| Molecular Formula | C23H31F3N4O5 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 2-[4-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)-(4,4,4-trifluorobutyl)amino]ethyl]phenoxy]-2-methylpentanoic acid |
| SMILES | CCCC(C)(Oc1ccc(CCN(CCCC(F)(F)F)c2nn(C)c(=O)n(C)c2=O)cc1)C(=O)O |
| InChI | InChI=1S/C23H31F3N4O5/c1-5-12-22(2,20(32)33)35-17-9-7-16(8-10-17)11-15-30(14-6-13-23(24,25)26)18-19(31)28(3)21(34)29(4)27-18/h7-10H,5-6,11-15H2,1-4H3,(H,32,33) |
| InChIKey | KJZSBVNGIGHXJN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |