C17H22BrN3O2 — CID 68582474
2-benzyl-6-bromo-4-heptyl-1,2,4-triazine-3,5-dione (PubChem CID 68582474) has the molecular formula C17H22BrN3O2 and a molecular weight of 380.29 g/mol. Its IUPAC name is 2-benzyl-6-bromo-4-heptyl-1,2,4-triazine-3,5-dione.
| Compound Name | 2-benzyl-6-bromo-4-heptyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 68582474 |
| Molecular Formula | C17H22BrN3O2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-benzyl-6-bromo-4-heptyl-1,2,4-triazine-3,5-dione |
| SMILES | CCCCCCCn1c(=O)c(Br)nn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C17H22BrN3O2/c1-2-3-4-5-9-12-20-16(22)15(18)19-21(17(20)23)13-14-10-7-6-8-11-14/h6-8,10-11H,2-5,9,12-13H2,1H3 |
| InChIKey | DRSGSLQLAFSKAS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|