C26H40N2O2 — CID 142656419
6-benzyl-1,3-dihexyl-5-propan-2-ylpyrimidine-2,4-dione (PubChem CID 142656419) has the molecular formula C26H40N2O2 and a molecular weight of 412.62 g/mol. Its IUPAC name is 6-benzyl-1,3-dihexyl-5-propan-2-ylpyrimidine-2,4-dione.
| Compound Name | 6-benzyl-1,3-dihexyl-5-propan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142656419 |
| Molecular Formula | C26H40N2O2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | 6-benzyl-1,3-dihexyl-5-propan-2-ylpyrimidine-2,4-dione |
| SMILES | CCCCCCn1c(Cc2ccccc2)c(C(C)C)c(=O)n(CCCCCC)c1=O |
| InChI | InChI=1S/C26H40N2O2/c1-5-7-9-14-18-27-23(20-22-16-12-11-13-17-22)24(21(3)4)25(29)28(26(27)30)19-15-10-8-6-2/h11-13,16-17,21H,5-10,14-15,18-20H2,1-4H3 |
| InChIKey | WCVCXNXDZUYMLA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|