C24H27FN2O2 — CID 52937849
6-benzyl-1-[4-(4-fluorophenyl)butyl]-5-propan-2-ylpyrimidine-2,4-dione (PubChem CID 52937849) has the molecular formula C24H27FN2O2 and a molecular weight of 394.49 g/mol. Its IUPAC name is 6-benzyl-1-[4-(4-fluorophenyl)butyl]-5-propan-2-ylpyrimidine-2,4-dione.
| Compound Name | 6-benzyl-1-[4-(4-fluorophenyl)butyl]-5-propan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 52937849 |
| Molecular Formula | C24H27FN2O2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 6-benzyl-1-[4-(4-fluorophenyl)butyl]-5-propan-2-ylpyrimidine-2,4-dione |
| SMILES | CC(C)c1c(Cc2ccccc2)n(CCCCc2ccc(F)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H27FN2O2/c1-17(2)22-21(16-19-9-4-3-5-10-19)27(24(29)26-23(22)28)15-7-6-8-18-11-13-20(25)14-12-18/h3-5,9-14,17H,6-8,15-16H2,1-2H3,(H,26,28,29) |
| InChIKey | DKGGDBPJOXTMPT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|