C27H30N2O5 — CID 11698348
[(Z)-4-[(6-benzyl-2,4-dioxo-5-propan-2-ylpyrimidin-1-yl)methoxy]but-2-enyl] 4-methylbenzoate (PubChem CID 11698348) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is [(Z)-4-[(6-benzyl-2,4-dioxo-5-propan-2-ylpyrimidin-1-yl)methoxy]but-2-enyl] 4-methylbenzoate.
| Compound Name | [(Z)-4-[(6-benzyl-2,4-dioxo-5-propan-2-ylpyrimidin-1-yl)methoxy]but-2-enyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 11698348 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | [(Z)-4-[(6-benzyl-2,4-dioxo-5-propan-2-ylpyrimidin-1-yl)methoxy]but-2-enyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC/C=C\COCn2c(Cc3ccccc3)c(C(C)C)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C27H30N2O5/c1-19(2)24-23(17-21-9-5-4-6-10-21)29(27(32)28-25(24)30)18-33-15-7-8-16-34-26(31)22-13-11-20(3)12-14-22/h4-14,19H,15-18H2,1-3H3,(H,28,30,32)/b8-7- |
| InChIKey | JIHKMRGLUMXLQL-FPLPWBNLSA-N |
| XLogP | 3.95 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|