C26H30N2O3 — CID 6480198
6-[(3,5-dimethylphenyl)methyl]-1-[[(E)-3-phenylprop-2-enoxy]methyl]-5-propylpyrimidine-2,4-dione (PubChem CID 6480198) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 6-[(3,5-dimethylphenyl)methyl]-1-[[(E)-3-phenylprop-2-enoxy]methyl]-5-propylpyrimidine-2,4-dione.
| Compound Name | 6-[(3,5-dimethylphenyl)methyl]-1-[[(E)-3-phenylprop-2-enoxy]methyl]-5-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 6480198 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 6-[(3,5-dimethylphenyl)methyl]-1-[[(E)-3-phenylprop-2-enoxy]methyl]-5-propylpyrimidine-2,4-dione |
| SMILES | CCCc1c(Cc2cc(C)cc(C)c2)n(COC/C=C/c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H30N2O3/c1-4-9-23-24(17-22-15-19(2)14-20(3)16-22)28(26(30)27-25(23)29)18-31-13-8-12-21-10-6-5-7-11-21/h5-8,10-12,14-16H,4,9,13,17-18H2,1-3H3,(H,27,29,30)/b12-8+ |
| InChIKey | MAPMMMYKLZSWAD-XYOKQWHBSA-N |
| XLogP | 4.38 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|