C30H30N2O4 — CID 10600839
6-benzyl-3-phenacyl-1-(phenylmethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione (PubChem CID 10600839) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is 6-benzyl-3-phenacyl-1-(phenylmethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione.
| Compound Name | 6-benzyl-3-phenacyl-1-(phenylmethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10600839 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 6-benzyl-3-phenacyl-1-(phenylmethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione |
| SMILES | CC(C)c1c(Cc2ccccc2)n(COCc2ccccc2)c(=O)n(CC(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C30H30N2O4/c1-22(2)28-26(18-23-12-6-3-7-13-23)32(21-36-20-24-14-8-4-9-15-24)30(35)31(29(28)34)19-27(33)25-16-10-5-11-17-25/h3-17,22H,18-21H2,1-2H3 |
| InChIKey | JUFAWSLGJHMUJY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |