C29H30N2O4 — CID 142656493
6-benzyl-5-ethyl-1,3-bis(phenylmethoxymethyl)pyrimidine-2,4-dione (PubChem CID 142656493) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is 6-benzyl-5-ethyl-1,3-bis(phenylmethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 6-benzyl-5-ethyl-1,3-bis(phenylmethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142656493 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 6-benzyl-5-ethyl-1,3-bis(phenylmethoxymethyl)pyrimidine-2,4-dione |
| SMILES | CCc1c(Cc2ccccc2)n(COCc2ccccc2)c(=O)n(COCc2ccccc2)c1=O |
| InChI | InChI=1S/C29H30N2O4/c1-2-26-27(18-23-12-6-3-7-13-23)30(21-34-19-24-14-8-4-9-15-24)29(33)31(28(26)32)22-35-20-25-16-10-5-11-17-25/h3-17H,2,18-22H2,1H3 |
| InChIKey | UBZLCSJBJVPTMA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |