C23H34N2O2 — CID 142656479
6-benzyl-5-ethyl-1,3-dipentylpyrimidine-2,4-dione (PubChem CID 142656479) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 6-benzyl-5-ethyl-1,3-dipentylpyrimidine-2,4-dione.
| Compound Name | 6-benzyl-5-ethyl-1,3-dipentylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142656479 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 6-benzyl-5-ethyl-1,3-dipentylpyrimidine-2,4-dione |
| SMILES | CCCCCn1c(Cc2ccccc2)c(CC)c(=O)n(CCCCC)c1=O |
| InChI | InChI=1S/C23H34N2O2/c1-4-7-12-16-24-21(18-19-14-10-9-11-15-19)20(6-3)22(26)25(23(24)27)17-13-8-5-2/h9-11,14-15H,4-8,12-13,16-18H2,1-3H3 |
| InChIKey | HASZNTIHULMKHY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|