C24H29NO4S — CID 143039525
ethyl 2-methyl-2-[3-[3-(5-methylsulfanyloxyindol-1-yl)propyl]phenoxy]propanoate (PubChem CID 143039525) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is ethyl 2-methyl-2-[3-[3-(5-methylsulfanyloxyindol-1-yl)propyl]phenoxy]propanoate.
| Compound Name | ethyl 2-methyl-2-[3-[3-(5-methylsulfanyloxyindol-1-yl)propyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 143039525 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | ethyl 2-methyl-2-[3-[3-(5-methylsulfanyloxyindol-1-yl)propyl]phenoxy]propanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1cccc(CCCn2ccc3cc(OSC)ccc32)c1 |
| InChI | InChI=1S/C24H29NO4S/c1-5-27-23(26)24(2,3)28-20-10-6-8-18(16-20)9-7-14-25-15-13-19-17-21(29-30-4)11-12-22(19)25/h6,8,10-13,15-17H,5,7,9,14H2,1-4H3 |
| InChIKey | GYCHUTRRGCIELX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|