C25H33NO5 — CID 23136279
ethyl 3-[3-methyl-4-[[3-(2-morpholin-4-ylethoxy)phenyl]methoxy]phenyl]propanoate (PubChem CID 23136279) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is ethyl 3-[3-methyl-4-[[3-(2-morpholin-4-ylethoxy)phenyl]methoxy]phenyl]propanoate.
| Compound Name | ethyl 3-[3-methyl-4-[[3-(2-morpholin-4-ylethoxy)phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 23136279 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | ethyl 3-[3-methyl-4-[[3-(2-morpholin-4-ylethoxy)phenyl]methoxy]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OCc2cccc(OCCN3CCOCC3)c2)c(C)c1 |
| InChI | InChI=1S/C25H33NO5/c1-3-29-25(27)10-8-21-7-9-24(20(2)17-21)31-19-22-5-4-6-23(18-22)30-16-13-26-11-14-28-15-12-26/h4-7,9,17-18H,3,8,10-16,19H2,1-2H3 |
| InChIKey | CDRGKRMGLLTYJI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |