C16H24N4O3S — CID 122609252
N-(methylaminocarbamothioyl)-2-[3-(2-morpholin-4-ylethoxy)phenyl]acetamide (PubChem CID 122609252) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is N-(methylaminocarbamothioyl)-2-[3-(2-morpholin-4-ylethoxy)phenyl]acetamide.
| Compound Name | N-(methylaminocarbamothioyl)-2-[3-(2-morpholin-4-ylethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 122609252 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-(methylaminocarbamothioyl)-2-[3-(2-morpholin-4-ylethoxy)phenyl]acetamide |
| SMILES | CNNC(=S)NC(=O)Cc1cccc(OCCN2CCOCC2)c1 |
| InChI | InChI=1S/C16H24N4O3S/c1-17-19-16(24)18-15(21)12-13-3-2-4-14(11-13)23-10-7-20-5-8-22-9-6-20/h2-4,11,17H,5-10,12H2,1H3,(H2,18,19,21,24) |
| InChIKey | WCJULEPKMRQMQG-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|