C20H28N4O3 — CID 48626511
3-(4-methylpyrazol-1-yl)-N-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]propanamide (PubChem CID 48626511) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 3-(4-methylpyrazol-1-yl)-N-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]propanamide.
| Compound Name | 3-(4-methylpyrazol-1-yl)-N-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 48626511 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 3-(4-methylpyrazol-1-yl)-N-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]propanamide |
| SMILES | Cc1cnn(CCC(=O)NCc2cccc(OCCN3CCOCC3)c2)c1 |
| InChI | InChI=1S/C20H28N4O3/c1-17-14-22-24(16-17)6-5-20(25)21-15-18-3-2-4-19(13-18)27-12-9-23-7-10-26-11-8-23/h2-4,13-14,16H,5-12,15H2,1H3,(H,21,25) |
| InChIKey | KBSJGXBMNBEWQP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |