C20H23Cl2N3O3 — CID 60590463
1-(3,4-dichlorophenyl)-3-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]urea (PubChem CID 60590463) has the molecular formula C20H23Cl2N3O3 and a molecular weight of 424.33 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 60590463 |
| Molecular Formula | C20H23Cl2N3O3 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]urea |
| SMILES | O=C(NCc1cccc(OCCN2CCOCC2)c1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H23Cl2N3O3/c21-18-5-4-16(13-19(18)22)24-20(26)23-14-15-2-1-3-17(12-15)28-11-8-25-6-9-27-10-7-25/h1-5,12-13H,6-11,14H2,(H2,23,24,26) |
| InChIKey | GASDIUAGQQDDFX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |