C21H30N2O5 — CID 22680140
2-[[3-(2-morpholin-4-ylethoxy)phenyl]methylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 22680140) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-[[3-(2-morpholin-4-ylethoxy)phenyl]methylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[[3-(2-morpholin-4-ylethoxy)phenyl]methylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 22680140 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-[[3-(2-morpholin-4-ylethoxy)phenyl]methylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(=O)NCc1cccc(OCCN2CCOCC2)c1 |
| InChI | InChI=1S/C21H30N2O5/c24-20(18-6-1-2-7-19(18)21(25)26)22-15-16-4-3-5-17(14-16)28-13-10-23-8-11-27-12-9-23/h3-5,14,18-19H,1-2,6-13,15H2,(H,22,24)(H,25,26) |
| InChIKey | YQGLYFQZHMIWNQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |