C22H32N2O4 — CID 22685902
2-[[3-(2-piperidin-1-ylethoxy)phenyl]methylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 22685902) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[[3-(2-piperidin-1-ylethoxy)phenyl]methylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[[3-(2-piperidin-1-ylethoxy)phenyl]methylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 22685902 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 2-[[3-(2-piperidin-1-ylethoxy)phenyl]methylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(=O)NCc1cccc(OCCN2CCCCC2)c1 |
| InChI | InChI=1S/C22H32N2O4/c25-21(19-9-2-3-10-20(19)22(26)27)23-16-17-7-6-8-18(15-17)28-14-13-24-11-4-1-5-12-24/h6-8,15,19-20H,1-5,9-14,16H2,(H,23,25)(H,26,27) |
| InChIKey | ZWSHMHSBIBAROK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |