C16H23NO3 — CID 97244220
(3R)-N-methyl-N-[(3-propan-2-yloxyphenyl)methyl]oxolane-3-carboxamide (PubChem CID 97244220) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (3R)-N-methyl-N-[(3-propan-2-yloxyphenyl)methyl]oxolane-3-carboxamide.
| Compound Name | (3R)-N-methyl-N-[(3-propan-2-yloxyphenyl)methyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 97244220 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (3R)-N-methyl-N-[(3-propan-2-yloxyphenyl)methyl]oxolane-3-carboxamide |
| SMILES | CC(C)Oc1cccc(CN(C)C(=O)[C@@H]2CCOC2)c1 |
| InChI | InChI=1S/C16H23NO3/c1-12(2)20-15-6-4-5-13(9-15)10-17(3)16(18)14-7-8-19-11-14/h4-6,9,12,14H,7-8,10-11H2,1-3H3/t14-/m1/s1 |
| InChIKey | XIEZQCVGYJFDEV-CQSZACIVSA-N |
| XLogP | 2.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |