C33H26O5 — CID 6125879
[4-[(E)-3-(4-methylphenyl)prop-2-enoyl]phenyl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 6125879) has the molecular formula C33H26O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is [4-[(E)-3-(4-methylphenyl)prop-2-enoyl]phenyl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | [4-[(E)-3-(4-methylphenyl)prop-2-enoyl]phenyl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6125879 |
| Molecular Formula | C33H26O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [4-[(E)-3-(4-methylphenyl)prop-2-enoyl]phenyl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | CCOc1ccc2oc(-c3ccccc3)c(C(=O)Oc3ccc(C(=O)/C=C/c4ccc(C)cc4)cc3)c2c1 |
| InChI | InChI=1S/C33H26O5/c1-3-36-27-18-20-30-28(21-27)31(32(38-30)25-7-5-4-6-8-25)33(35)37-26-16-14-24(15-17-26)29(34)19-13-23-11-9-22(2)10-12-23/h4-21H,3H2,1-2H3/b19-13+ |
| InChIKey | JMYXWWNSPKTOMK-CPNJWEJPSA-N |
| XLogP | 7.92 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|