C33H26O6 — CID 6126069
[2-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenyl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 6126069) has the molecular formula C33H26O6 and a molecular weight of 518.57 g/mol. Its IUPAC name is [2-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenyl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | [2-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenyl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6126069 |
| Molecular Formula | C33H26O6 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | [2-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenyl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | CCOc1ccc2oc(-c3ccccc3)c(C(=O)Oc3ccccc3/C=C/C(=O)c3ccc(OC)cc3)c2c1 |
| InChI | InChI=1S/C33H26O6/c1-3-37-26-18-20-30-27(21-26)31(32(38-30)24-10-5-4-6-11-24)33(35)39-29-12-8-7-9-23(29)15-19-28(34)22-13-16-25(36-2)17-14-22/h4-21H,3H2,1-2H3/b19-15+ |
| InChIKey | NVRODWBEXQXIET-XDJHFCHBSA-N |
| XLogP | 7.62 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|