C31H22O5 — CID 6125391
[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 6125391) has the molecular formula C31H22O5 and a molecular weight of 474.51 g/mol. Its IUPAC name is [4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | [4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6125391 |
| Molecular Formula | C31H22O5 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | [4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | COc1ccc2oc(-c3ccccc3)c(C(=O)Oc3ccc(/C=C/C(=O)c4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C31H22O5/c1-34-25-17-19-28-26(20-25)29(30(36-28)23-10-6-3-7-11-23)31(33)35-24-15-12-21(13-16-24)14-18-27(32)22-8-4-2-5-9-22/h2-20H,1H3/b18-14+ |
| InChIKey | XNDITFOMYCRNBZ-NBVRZTHBSA-N |
| XLogP | 7.22 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|