C34H28O7 — CID 6126309
[4-[(E)-3-(2,5-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate (PubChem CID 6126309) has the molecular formula C34H28O7 and a molecular weight of 548.59 g/mol. Its IUPAC name is [4-[(E)-3-(2,5-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate.
| Compound Name | [4-[(E)-3-(2,5-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6126309 |
| Molecular Formula | C34H28O7 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | [4-[(E)-3-(2,5-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
| SMILES | COc1ccc(OC)c(C(=O)/C=C/c2ccc(OC(=O)c3c(C)oc4ccc(OCc5ccccc5)cc34)cc2)c1 |
| InChI | InChI=1S/C34H28O7/c1-22-33(29-20-27(15-18-32(29)40-22)39-21-24-7-5-4-6-8-24)34(36)41-25-12-9-23(10-13-25)11-16-30(35)28-19-26(37-2)14-17-31(28)38-3/h4-20H,21H2,1-3H3/b16-11+ |
| InChIKey | INHRSEUYBVOFLJ-LFIBNONCSA-N |
| XLogP | 7.45 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|