C38H28O5 — CID 6126384
[3-[(E)-3-oxo-3-(4-phenylphenyl)prop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate (PubChem CID 6126384) has the molecular formula C38H28O5 and a molecular weight of 564.64 g/mol. Its IUPAC name is [3-[(E)-3-oxo-3-(4-phenylphenyl)prop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate.
| Compound Name | [3-[(E)-3-oxo-3-(4-phenylphenyl)prop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6126384 |
| Molecular Formula | C38H28O5 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | [3-[(E)-3-oxo-3-(4-phenylphenyl)prop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
| SMILES | Cc1oc2ccc(OCc3ccccc3)cc2c1C(=O)Oc1cccc(/C=C/C(=O)c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C38H28O5/c1-26-37(34-24-32(20-22-36(34)42-26)41-25-28-9-4-2-5-10-28)38(40)43-33-14-8-11-27(23-33)15-21-35(39)31-18-16-30(17-19-31)29-12-6-3-7-13-29/h2-24H,25H2,1H3/b21-15+ |
| InChIKey | DSMYYSYXWDMJNR-RCCKNPSSSA-N |
| XLogP | 9.10 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|