C32H23BrO5 — CID 6126448
[2-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate (PubChem CID 6126448) has the molecular formula C32H23BrO5 and a molecular weight of 567.44 g/mol. Its IUPAC name is [2-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate.
| Compound Name | [2-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6126448 |
| Molecular Formula | C32H23BrO5 |
| Molecular Weight | 567.44 g/mol |
| Exact Mass | 566.07 |
| IUPAC Name | [2-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
| SMILES | Cc1oc2ccc(OCc3ccccc3)cc2c1C(=O)Oc1ccccc1/C=C/C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C32H23BrO5/c1-21-31(27-19-26(16-18-30(27)37-21)36-20-22-7-3-2-4-8-22)32(35)38-29-10-6-5-9-24(29)13-17-28(34)23-11-14-25(33)15-12-23/h2-19H,20H2,1H3/b17-13+ |
| InChIKey | WGKFCILEEXSDFC-GHRIWEEISA-N |
| XLogP | 8.20 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.44 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|