C32H22Cl2O5 — CID 6126377
[4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate (PubChem CID 6126377) has the molecular formula C32H22Cl2O5 and a molecular weight of 557.43 g/mol. Its IUPAC name is [4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate.
| Compound Name | [4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6126377 |
| Molecular Formula | C32H22Cl2O5 |
| Molecular Weight | 557.43 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | [4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
| SMILES | Cc1oc2ccc(OCc3ccccc3)cc2c1C(=O)Oc1ccc(C(=O)/C=C/c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C32H22Cl2O5/c1-20-31(26-18-24(14-17-30(26)38-20)37-19-21-6-3-2-4-7-21)32(36)39-23-12-10-22(11-13-23)29(35)16-15-25-27(33)8-5-9-28(25)34/h2-18H,19H2,1H3/b16-15+ |
| InChIKey | SFRVFKJJNJRLKA-FOCLMDBBSA-N |
| XLogP | 8.74 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.43 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|