C32H23ClO5 — CID 6126121
[3-[(E)-3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate (PubChem CID 6126121) has the molecular formula C32H23ClO5 and a molecular weight of 522.98 g/mol. Its IUPAC name is [3-[(E)-3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate.
| Compound Name | [3-[(E)-3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6126121 |
| Molecular Formula | C32H23ClO5 |
| Molecular Weight | 522.98 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | [3-[(E)-3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
| SMILES | Cc1oc2ccc(OCc3ccccc3)cc2c1C(=O)Oc1cccc(/C=C/C(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C32H23ClO5/c1-21-31(28-19-26(15-17-30(28)37-21)36-20-23-6-3-2-4-7-23)32(35)38-27-9-5-8-22(18-27)10-16-29(34)24-11-13-25(33)14-12-24/h2-19H,20H2,1H3/b16-10+ |
| InChIKey | ICXLWSALRGKKAQ-MHWRWJLKSA-N |
| XLogP | 8.09 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.98 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|