C33H26O7 — CID 6126185
[4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 6126185) has the molecular formula C33H26O7 and a molecular weight of 534.56 g/mol. Its IUPAC name is [4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | [4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6126185 |
| Molecular Formula | C33H26O7 |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | [4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]phenyl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OC(=O)c3c(-c4ccccc4)oc4ccc(OC)cc34)cc2)c(OC)c1 |
| InChI | InChI=1S/C33H26O7/c1-36-25-16-18-29-27(19-25)31(32(40-29)23-7-5-4-6-8-23)33(35)39-24-13-9-21(10-14-24)28(34)17-12-22-11-15-26(37-2)20-30(22)38-3/h4-20H,1-3H3/b17-12+ |
| InChIKey | AQNJVBMCFUENGW-SFQUDFHCSA-N |
| XLogP | 7.24 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|