C34H28O7 — CID 6126317
[2-methoxy-4-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenyl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 6126317) has the molecular formula C34H28O7 and a molecular weight of 548.59 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenyl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | [2-methoxy-4-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenyl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6126317 |
| Molecular Formula | C34H28O7 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | [2-methoxy-4-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenyl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | CCOc1ccc2oc(-c3ccccc3)c(C(=O)Oc3ccc(/C=C/C(=O)c4ccc(OC)cc4)cc3OC)c2c1 |
| InChI | InChI=1S/C34H28O7/c1-4-39-26-16-19-29-27(21-26)32(33(40-29)24-8-6-5-7-9-24)34(36)41-30-18-11-22(20-31(30)38-3)10-17-28(35)23-12-14-25(37-2)15-13-23/h5-21H,4H2,1-3H3/b17-10+ |
| InChIKey | AXLNZXLEYGZILL-LICLKQGHSA-N |
| XLogP | 7.63 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|