C30H28O8 — CID 6126022
[4-[(E)-3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-methoxyphenyl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 6126022) has the molecular formula C30H28O8 and a molecular weight of 516.55 g/mol. Its IUPAC name is [4-[(E)-3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-methoxyphenyl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | [4-[(E)-3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-methoxyphenyl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6126022 |
| Molecular Formula | C30H28O8 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | [4-[(E)-3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-methoxyphenyl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCOc1ccc2oc(C)c(C(=O)Oc3ccc(/C=C/C(=O)c4ccc(OC)cc4OC)cc3OC)c2c1 |
| InChI | InChI=1S/C30H28O8/c1-6-36-21-10-14-25-23(16-21)29(18(2)37-25)30(32)38-26-13-8-19(15-28(26)35-5)7-12-24(31)22-11-9-20(33-3)17-27(22)34-4/h7-17H,6H2,1-5H3/b12-7+ |
| InChIKey | GPVATUWBSJACKF-KPKJPENVSA-N |
| XLogP | 6.28 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|