C26H18O6 — CID 102256311
5,7-dimethoxy-2-(2-oxochromen-3-yl)-3-phenylchromen-4-one (PubChem CID 102256311) has the molecular formula C26H18O6 and a molecular weight of 426.42 g/mol. Its IUPAC name is 5,7-dimethoxy-2-(2-oxochromen-3-yl)-3-phenylchromen-4-one.
| Compound Name | 5,7-dimethoxy-2-(2-oxochromen-3-yl)-3-phenylchromen-4-one |
|---|---|
| PubChem CID | 102256311 |
| Molecular Formula | C26H18O6 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 5,7-dimethoxy-2-(2-oxochromen-3-yl)-3-phenylchromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(-c3ccccc3)c(-c3cc4ccccc4oc3=O)oc2c1 |
| InChI | InChI=1S/C26H18O6/c1-29-17-13-20(30-2)23-21(14-17)31-25(22(24(23)27)15-8-4-3-5-9-15)18-12-16-10-6-7-11-19(16)32-26(18)28/h3-14H,1-2H3 |
| InChIKey | DPRGQRPMBCDNJW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|