About 3-phenylchromen-2-one;hydrochloride
3-phenylchromen-2-one;hydrochloride (PubChem CID 141206894) has the molecular formula C15H11ClO2
and a molecular weight of 258.70 g/mol. Its IUPAC name is 3-phenylchromen-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-phenylchromen-2-one;hydrochloride |
| PubChem CID | 141206894 |
| Molecular Formula | C15H11ClO2 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 3-phenylchromen-2-one;hydrochloride |
| SMILES | Cl.O=c1oc2ccccc2cc1-c1ccccc1 |
| InChI | InChI=1S/C15H10O2.ClH/c16-15-13(11-6-2-1-3-7-11)10-12-8-4-5-9-14(12)17-15;/h1-10H;1H |
| InChIKey | RANHVMYUJUGYFI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylchromen-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylchromen-2-one;hydrochloride?
The IUPAC name of 3-phenylchromen-2-one;hydrochloride (CID 141206894) is 3-phenylchromen-2-one;hydrochloride.
What is the SMILES notation for 3-phenylchromen-2-one;hydrochloride?
The canonical SMILES for 3-phenylchromen-2-one;hydrochloride is Cl.O=c1oc2ccccc2cc1-c1ccccc1.
What is the InChIKey of 3-phenylchromen-2-one;hydrochloride?
The InChIKey is RANHVMYUJUGYFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O2.ClH/c16-15-13(11-6-2-1-3-7-11)10-12-8-4-5-9-14(12)17-15;/h1-10H;1H.
What are the key properties of 3-phenylchromen-2-one;hydrochloride?
3-phenylchromen-2-one;hydrochloride has a molecular weight of 258.70 g/mol, XLogP of 3.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylchromen-2-one;hydrochloride is sourced from PubChem (CID 141206894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).