C52H28N2O8 — CID 155815853
3-[4-[4-[2,6-bis(2-oxochromen-3-yl)-4-pyridinyl]phenyl]-6-(2-oxochromen-3-yl)-2-pyridinyl]chromen-2-one (PubChem CID 155815853) has the molecular formula C52H28N2O8 and a molecular weight of 808.80 g/mol. Its IUPAC name is 3-[4-[4-[2,6-bis(2-oxochromen-3-yl)-4-pyridinyl]phenyl]-6-(2-oxochromen-3-yl)-2-pyridinyl]chromen-2-one.
| Compound Name | 3-[4-[4-[2,6-bis(2-oxochromen-3-yl)-4-pyridinyl]phenyl]-6-(2-oxochromen-3-yl)-2-pyridinyl]chromen-2-one |
|---|---|
| PubChem CID | 155815853 |
| Molecular Formula | C52H28N2O8 |
| Molecular Weight | 808.80 g/mol |
| Exact Mass | 808.18 |
| IUPAC Name | 3-[4-[4-[2,6-bis(2-oxochromen-3-yl)-4-pyridinyl]phenyl]-6-(2-oxochromen-3-yl)-2-pyridinyl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1cc(-c2ccc(-c3cc(-c4cc5ccccc5oc4=O)nc(-c4cc5ccccc5oc4=O)c3)cc2)cc(-c2cc3ccccc3oc2=O)n1 |
| InChI | InChI=1S/C52H28N2O8/c55-49-37(21-31-9-1-5-13-45(31)59-49)41-25-35(26-42(53-41)38-22-32-10-2-6-14-46(32)60-50(38)56)29-17-19-30(20-18-29)36-27-43(39-23-33-11-3-7-15-47(33)61-51(39)57)54-44(28-36)40-24-34-12-4-8-16-48(34)62-52(40)58/h1-28H |
| InChIKey | PSFSJSZBDJVMEE-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 146.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.80 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|