C13H8N2O2S — CID 71419333
3-[2-(methylideneamino)-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 71419333) has the molecular formula C13H8N2O2S and a molecular weight of 256.29 g/mol. Its IUPAC name is 3-[2-(methylideneamino)-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 3-[2-(methylideneamino)-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 71419333 |
| Molecular Formula | C13H8N2O2S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 3-[2-(methylideneamino)-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | C=Nc1nc(-c2cc3ccccc3oc2=O)cs1 |
| InChI | InChI=1S/C13H8N2O2S/c1-14-13-15-10(7-18-13)9-6-8-4-2-3-5-11(8)17-12(9)16/h2-7H,1H2 |
| InChIKey | ITYADJVPWIOYLI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|