C24H15NO3 — CID 14320030
3-(4,5-diphenyl-1,3-oxazol-2-yl)chromen-2-one (PubChem CID 14320030) has the molecular formula C24H15NO3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-(4,5-diphenyl-1,3-oxazol-2-yl)chromen-2-one.
| Compound Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 14320030 |
| Molecular Formula | C24H15NO3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C24H15NO3/c26-24-19(15-18-13-7-8-14-20(18)27-24)23-25-21(16-9-3-1-4-10-16)22(28-23)17-11-5-2-6-12-17/h1-15H |
| InChIKey | GMBQLFUOMQSESM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|