C26H19NO3 — CID 137183963
3-(4,5-diphenyl-1,3-oxazol-2-yl)-6-methoxynaphthalen-2-ol (PubChem CID 137183963) has the molecular formula C26H19NO3 and a molecular weight of 393.44 g/mol. Its IUPAC name is 3-(4,5-diphenyl-1,3-oxazol-2-yl)-6-methoxynaphthalen-2-ol.
| Compound Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)-6-methoxynaphthalen-2-ol |
|---|---|
| PubChem CID | 137183963 |
| Molecular Formula | C26H19NO3 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)-6-methoxynaphthalen-2-ol |
| SMILES | COc1ccc2cc(O)c(-c3nc(-c4ccccc4)c(-c4ccccc4)o3)cc2c1 |
| InChI | InChI=1S/C26H19NO3/c1-29-21-13-12-19-16-23(28)22(15-20(19)14-21)26-27-24(17-8-4-2-5-9-17)25(30-26)18-10-6-3-7-11-18/h2-16,28H,1H3 |
| InChIKey | AMSMVXJERXKLGR-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |