C26H17NO3 — CID 10430529
6-(4,5-diphenyl-1,3-oxazol-2-yl)naphthalene-2-carboxylic acid (PubChem CID 10430529) has the molecular formula C26H17NO3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 6-(4,5-diphenyl-1,3-oxazol-2-yl)naphthalene-2-carboxylic acid.
| Compound Name | 6-(4,5-diphenyl-1,3-oxazol-2-yl)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 10430529 |
| Molecular Formula | C26H17NO3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 6-(4,5-diphenyl-1,3-oxazol-2-yl)naphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2cc(-c3nc(-c4ccccc4)c(-c4ccccc4)o3)ccc2c1 |
| InChI | InChI=1S/C26H17NO3/c28-26(29)22-14-12-19-15-21(13-11-20(19)16-22)25-27-23(17-7-3-1-4-8-17)24(30-25)18-9-5-2-6-10-18/h1-16H,(H,28,29) |
| InChIKey | XNVFEBLZUGETCL-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |