C29H25NO3 — CID 21196529
3-[[3-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-3-en-1-yl]methyl]benzoic acid (PubChem CID 21196529) has the molecular formula C29H25NO3 and a molecular weight of 435.52 g/mol. Its IUPAC name is 3-[[3-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-3-en-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[3-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-3-en-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 21196529 |
| Molecular Formula | C29H25NO3 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 3-[[3-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-3-en-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CC2CCC=C(c3nc(-c4ccccc4)c(-c4ccccc4)o3)C2)c1 |
| InChI | InChI=1S/C29H25NO3/c31-29(32)25-16-8-10-21(19-25)17-20-9-7-15-24(18-20)28-30-26(22-11-3-1-4-12-22)27(33-28)23-13-5-2-6-14-23/h1-6,8,10-16,19-20H,7,9,17-18H2,(H,31,32) |
| InChIKey | GHVHANRGZIBIRA-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |