C39H36N2O4 — CID 18459154
3-[3-[[2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]phenyl]-3-oxo-2-(2-phenylethylamino)propanoic acid (PubChem CID 18459154) has the molecular formula C39H36N2O4 and a molecular weight of 596.73 g/mol. Its IUPAC name is 3-[3-[[2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]phenyl]-3-oxo-2-(2-phenylethylamino)propanoic acid.
| Compound Name | 3-[3-[[2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]phenyl]-3-oxo-2-(2-phenylethylamino)propanoic acid |
|---|---|
| PubChem CID | 18459154 |
| Molecular Formula | C39H36N2O4 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | 3-[3-[[2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]phenyl]-3-oxo-2-(2-phenylethylamino)propanoic acid |
| SMILES | O=C(O)C(NCCc1ccccc1)C(=O)c1cccc(CC2CCCC=C2c2nc(-c3ccccc3)c(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C39H36N2O4/c42-36(35(39(43)44)40-24-23-27-13-4-1-5-14-27)32-21-12-15-28(26-32)25-31-20-10-11-22-33(31)38-41-34(29-16-6-2-7-17-29)37(45-38)30-18-8-3-9-19-30/h1-9,12-19,21-22,26,31,35,40H,10-11,20,23-25H2,(H,43,44) |
| InChIKey | BENBNINVHJHJGH-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|