C28H25NO3 — CID 11327698
3-[[(1S,2R)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclopentyl]methyl]benzoic acid (PubChem CID 11327698) has the molecular formula C28H25NO3 and a molecular weight of 423.51 g/mol. Its IUPAC name is 3-[[(1S,2R)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclopentyl]methyl]benzoic acid.
| Compound Name | 3-[[(1S,2R)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclopentyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 11327698 |
| Molecular Formula | C28H25NO3 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-[[(1S,2R)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclopentyl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C[C@@H]2CCC[C@H]2c2nc(-c3ccccc3)c(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C28H25NO3/c30-28(31)23-15-7-9-19(18-23)17-22-14-8-16-24(22)27-29-25(20-10-3-1-4-11-20)26(32-27)21-12-5-2-6-13-21/h1-7,9-13,15,18,22,24H,8,14,16-17H2,(H,30,31)/t22-,24+/m0/s1 |
| InChIKey | ALBLWZJSKRUNIH-LADGPHEKSA-N |
| XLogP | 6.83 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |