C29H29NO2 — CID 19358458
2-[3-[(3-methoxyphenyl)methyl]cyclohexyl]-4,5-diphenyl-1,3-oxazole (PubChem CID 19358458) has the molecular formula C29H29NO2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-[3-[(3-methoxyphenyl)methyl]cyclohexyl]-4,5-diphenyl-1,3-oxazole.
| Compound Name | 2-[3-[(3-methoxyphenyl)methyl]cyclohexyl]-4,5-diphenyl-1,3-oxazole |
|---|---|
| PubChem CID | 19358458 |
| Molecular Formula | C29H29NO2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 2-[3-[(3-methoxyphenyl)methyl]cyclohexyl]-4,5-diphenyl-1,3-oxazole |
| SMILES | COc1cccc(CC2CCCC(c3nc(-c4ccccc4)c(-c4ccccc4)o3)C2)c1 |
| InChI | InChI=1S/C29H29NO2/c1-31-26-17-9-11-22(20-26)18-21-10-8-16-25(19-21)29-30-27(23-12-4-2-5-13-23)28(32-29)24-14-6-3-7-15-24/h2-7,9,11-15,17,20-21,25H,8,10,16,18-19H2,1H3 |
| InChIKey | ZYSHCYWMVBFNBO-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |