C28H25NO2 — CID 21196500
2-[3-(3-methoxyphenyl)cyclohexen-1-yl]-4,5-diphenyl-1,3-oxazole (PubChem CID 21196500) has the molecular formula C28H25NO2 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-[3-(3-methoxyphenyl)cyclohexen-1-yl]-4,5-diphenyl-1,3-oxazole.
| Compound Name | 2-[3-(3-methoxyphenyl)cyclohexen-1-yl]-4,5-diphenyl-1,3-oxazole |
|---|---|
| PubChem CID | 21196500 |
| Molecular Formula | C28H25NO2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 2-[3-(3-methoxyphenyl)cyclohexen-1-yl]-4,5-diphenyl-1,3-oxazole |
| SMILES | COc1cccc(C2C=C(c3nc(-c4ccccc4)c(-c4ccccc4)o3)CCC2)c1 |
| InChI | InChI=1S/C28H25NO2/c1-30-25-17-9-15-23(19-25)22-14-8-16-24(18-22)28-29-26(20-10-4-2-5-11-20)27(31-28)21-12-6-3-7-13-21/h2-7,9-13,15,17-19,22H,8,14,16H2,1H3 |
| InChIKey | SJLOITVVBKQCRV-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |