C20H21NO2 — CID 10804668
(3R,8aR)-6-(3-methoxyphenyl)-3-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine (PubChem CID 10804668) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3R,8aR)-6-(3-methoxyphenyl)-3-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine.
| Compound Name | (3R,8aR)-6-(3-methoxyphenyl)-3-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine |
|---|---|
| PubChem CID | 10804668 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (3R,8aR)-6-(3-methoxyphenyl)-3-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine |
| SMILES | COc1cccc(C2=CN3[C@@H](CC2)OC[C@H]3c2ccccc2)c1 |
| InChI | InChI=1S/C20H21NO2/c1-22-18-9-5-8-16(12-18)17-10-11-20-21(13-17)19(14-23-20)15-6-3-2-4-7-15/h2-9,12-13,19-20H,10-11,14H2,1H3/t19-,20+/m0/s1 |
| InChIKey | RWAWGLBDLGZSFW-VQTJNVASSA-N |
| XLogP | 4.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |