C16H15NO3 — CID 34179074
(4S)-3-(3-methoxyphenyl)-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 34179074) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is (4S)-3-(3-methoxyphenyl)-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-(3-methoxyphenyl)-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 34179074 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (4S)-3-(3-methoxyphenyl)-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | COc1cccc(N2C(=O)OC[C@@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C16H15NO3/c1-19-14-9-5-8-13(10-14)17-15(11-20-16(17)18)12-6-3-2-4-7-12/h2-10,15H,11H2,1H3/t15-/m1/s1 |
| InChIKey | BURUWCICNVETPL-OAHLLOKOSA-N |
| XLogP | 3.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |